C11H20O2 — CID 134969824
(E,6S,7R)-7-hydroxy-6,8-dimethylnon-4-en-3-one (PubChem CID 134969824) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E,6S,7R)-7-hydroxy-6,8-dimethylnon-4-en-3-one.
| Compound Name | (E,6S,7R)-7-hydroxy-6,8-dimethylnon-4-en-3-one |
|---|---|
| PubChem CID | 134969824 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E,6S,7R)-7-hydroxy-6,8-dimethylnon-4-en-3-one |
| SMILES | CCC(=O)/C=C/[C@H](C)[C@H](O)C(C)C |
| InChI | InChI=1S/C11H20O2/c1-5-10(12)7-6-9(4)11(13)8(2)3/h6-9,11,13H,5H2,1-4H3/b7-6+/t9-,11+/m0/s1 |
| InChIKey | ILGFSISNGJIQFS-DLJWJUBYSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|