C25H42O4 — CID 139585243
(4E,6S,7S,8E,10S,11S,12E,14S,15S,16E)-7,11,15-trihydroxy-4,6,8,10,12,14,16-heptamethyloctadeca-4,8,12,16-tetraen-3-one (PubChem CID 139585243) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (4E,6S,7S,8E,10S,11S,12E,14S,15S,16E)-7,11,15-trihydroxy-4,6,8,10,12,14,16-heptamethyloctadeca-4,8,12,16-tetraen-3-one.
| Compound Name | (4E,6S,7S,8E,10S,11S,12E,14S,15S,16E)-7,11,15-trihydroxy-4,6,8,10,12,14,16-heptamethyloctadeca-4,8,12,16-tetraen-3-one |
|---|---|
| PubChem CID | 139585243 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (4E,6S,7S,8E,10S,11S,12E,14S,15S,16E)-7,11,15-trihydroxy-4,6,8,10,12,14,16-heptamethyloctadeca-4,8,12,16-tetraen-3-one |
| SMILES | C/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)C(=O)CC |
| InChI | InChI=1S/C25H42O4/c1-10-15(3)23(27)18(6)13-19(7)25(29)21(9)14-20(8)24(28)17(5)12-16(4)22(26)11-2/h10,12-14,17-18,21,23-25,27-29H,11H2,1-9H3/b15-10+,16-12+,19-13+,20-14+/t17-,18-,21-,23+,24-,25+/m0/s1 |
| InChIKey | CNANVYFHRUYPAQ-LPQRYZSGSA-N |
| XLogP | 4.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|