C14H20O2S — CID 134970894
(3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyl-2-phenylsulfanyloxolane (PubChem CID 134970894) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is (3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyl-2-phenylsulfanyloxolane.
| Compound Name | (3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyl-2-phenylsulfanyloxolane |
|---|---|
| PubChem CID | 134970894 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyl-2-phenylsulfanyloxolane |
| SMILES | CO[C@@H](C)[C@H]1C[C@H](C)C(Sc2ccccc2)O1 |
| InChI | InChI=1S/C14H20O2S/c1-10-9-13(11(2)15-3)16-14(10)17-12-7-5-4-6-8-12/h4-8,10-11,13-14H,9H2,1-3H3/t10-,11-,13+,14?/m0/s1 |
| InChIKey | PAGSPHYZXHUSDE-DZFSTHSVSA-N |
| XLogP | 3.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |