C18H33NO2SSi — CID 134971582
(S)-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-methylbenzenesulfinamide (PubChem CID 134971582) has the molecular formula C18H33NO2SSi and a molecular weight of 355.62 g/mol. Its IUPAC name is (S)-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-methylbenzenesulfinamide.
| Compound Name | (S)-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 134971582 |
| Molecular Formula | C18H33NO2SSi |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (S)-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-methylbenzenesulfinamide |
| SMILES | Cc1ccc([S@](=O)N[C@H](CO[Si](C)(C)C(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C18H33NO2SSi/c1-14(2)17(13-21-23(7,8)18(4,5)6)19-22(20)16-11-9-15(3)10-12-16/h9-12,14,17,19H,13H2,1-8H3/t17-,22+/m1/s1 |
| InChIKey | ZTKKELPHVOYBCJ-VGSWGCGISA-N |
| XLogP | 4.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|