C16H27N2O+ — CID 134972275
1-methyl-3-[2-[[(1S,2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]imidazol-1-ium (PubChem CID 134972275) has the molecular formula C16H27N2O+ and a molecular weight of 263.40 g/mol. Its IUPAC name is 1-methyl-3-[2-[[(1S,2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]imidazol-1-ium.
| Compound Name | 1-methyl-3-[2-[[(1S,2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]imidazol-1-ium |
|---|---|
| PubChem CID | 134972275 |
| Molecular Formula | C16H27N2O+ |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 1-methyl-3-[2-[[(1S,2S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]imidazol-1-ium |
| SMILES | C[n+]1ccn(CCO[C@H]2CC3CC[C@@]2(C)C3(C)C)c1 |
| InChI | InChI=1S/C16H27N2O/c1-15(2)13-5-6-16(15,3)14(11-13)19-10-9-18-8-7-17(4)12-18/h7-8,12-14H,5-6,9-11H2,1-4H3/q+1/t13?,14-,16+/m0/s1 |
| InChIKey | YVJDKYMAYRFBDK-JGKCFBKVSA-N |
| XLogP | 2.54 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|