C11H13NOS — CID 134972324
2-benzylsulfanyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 134972324) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-benzylsulfanyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | 2-benzylsulfanyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 134972324 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-benzylsulfanyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | c1ccc(CSC2=NCCCO2)cc1 |
| InChI | InChI=1S/C11H13NOS/c1-2-5-10(6-3-1)9-14-11-12-7-4-8-13-11/h1-3,5-6H,4,7-9H2 |
| InChIKey | MYISHPWZTHJVMC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |