C11H13NOS2 — CID 15156774
2-benzylsulfanyl-5-methoxy-4,5-dihydro-1,3-thiazole (PubChem CID 15156774) has the molecular formula C11H13NOS2 and a molecular weight of 239.37 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-methoxy-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-benzylsulfanyl-5-methoxy-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 15156774 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-benzylsulfanyl-5-methoxy-4,5-dihydro-1,3-thiazole |
| SMILES | COC1CN=C(SCc2ccccc2)S1 |
| InChI | InChI=1S/C11H13NOS2/c1-13-10-7-12-11(15-10)14-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | IKRWYPHSXWMUJT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |