C11H10O3 — CID 134972391
(2S)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylic acid (PubChem CID 134972391) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2S)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylic acid.
| Compound Name | (2S)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylic acid |
|---|---|
| PubChem CID | 134972391 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2S)-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-2-carboxylic acid |
| SMILES | O=C1C=C[C@]2(C(=O)O)C3C=CC(C3)C12 |
| InChI | InChI=1S/C11H10O3/c12-8-3-4-11(10(13)14)7-2-1-6(5-7)9(8)11/h1-4,6-7,9H,5H2,(H,13,14)/t6?,7?,9?,11-/m0/s1 |
| InChIKey | HTJATBSCOTZHLX-UQXIVWOUSA-N |
| XLogP | 1.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|