C16H25O3- — CID 134972571
2-[(1S,5S)-5-(hydroxymethyl)-1,2,5-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]acetate (PubChem CID 134972571) has the molecular formula C16H25O3- and a molecular weight of 265.37 g/mol. Its IUPAC name is 2-[(1S,5S)-5-(hydroxymethyl)-1,2,5-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]acetate.
| Compound Name | 2-[(1S,5S)-5-(hydroxymethyl)-1,2,5-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 134972571 |
| Molecular Formula | C16H25O3- |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-[(1S,5S)-5-(hydroxymethyl)-1,2,5-trimethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]acetate |
| SMILES | CC1CCC2=C(CCC[C@]2(C)CO)[C@@]1(C)CC(=O)[O-] |
| InChI | InChI=1S/C16H26O3/c1-11-6-7-12-13(16(11,3)9-14(18)19)5-4-8-15(12,2)10-17/h11,17H,4-10H2,1-3H3,(H,18,19)/p-1/t11?,15-,16+/m1/s1 |
| InChIKey | AKXSWYFXXBHQOI-ZNQYIGRYSA-M |
| XLogP | 2.04 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|