C17H29NO5S2 — CID 134972675
N-[(R)-(2-deuterio-1,3-dithian-2-yl)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]acetamide (PubChem CID 134972675) has the molecular formula C17H29NO5S2 and a molecular weight of 392.56 g/mol. Its IUPAC name is N-[(R)-(2-deuterio-1,3-dithian-2-yl)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]acetamide.
| Compound Name | N-[(R)-(2-deuterio-1,3-dithian-2-yl)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 134972675 |
| Molecular Formula | C17H29NO5S2 |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[(R)-(2-deuterio-1,3-dithian-2-yl)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]acetamide |
| SMILES | [2H]C1([C@H](NC(C)=O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)SCCCS1 |
| InChI | InChI=1S/C17H29NO5S2/c1-10(19)18-12(15-24-7-6-8-25-15)14-13(22-17(4,5)23-14)11-9-20-16(2,3)21-11/h11-15H,6-9H2,1-5H3,(H,18,19)/t11-,12-,13-,14-/m1/s1/i15D |
| InChIKey | BUMWNWGPWGGNSS-RGKKKZQUSA-N |
| XLogP | 2.36 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |