C17H36O3Si — CID 134974022
(2S,3S)-3,4,4-trimethyl-2-tri(propan-2-yl)silylperoxypentanal (PubChem CID 134974022) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is (2S,3S)-3,4,4-trimethyl-2-tri(propan-2-yl)silylperoxypentanal.
| Compound Name | (2S,3S)-3,4,4-trimethyl-2-tri(propan-2-yl)silylperoxypentanal |
|---|---|
| PubChem CID | 134974022 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2S,3S)-3,4,4-trimethyl-2-tri(propan-2-yl)silylperoxypentanal |
| SMILES | CC(C)[Si](OO[C@H](C=O)[C@@H](C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-12(2)21(13(3)4,14(5)6)20-19-16(11-18)15(7)17(8,9)10/h11-16H,1-10H3/t15-,16-/m1/s1 |
| InChIKey | YMKJNMJRBHQWRO-HZPDHXFCSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|