C15H26O3 — CID 134974414
4-[(2R,3S)-2-methyl-4-methylideneoxolan-3-yl]butyl 2,2-dimethylpropanoate (PubChem CID 134974414) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-[(2R,3S)-2-methyl-4-methylideneoxolan-3-yl]butyl 2,2-dimethylpropanoate.
| Compound Name | 4-[(2R,3S)-2-methyl-4-methylideneoxolan-3-yl]butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134974414 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 4-[(2R,3S)-2-methyl-4-methylideneoxolan-3-yl]butyl 2,2-dimethylpropanoate |
| SMILES | C=C1CO[C@H](C)[C@H]1CCCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H26O3/c1-11-10-18-12(2)13(11)8-6-7-9-17-14(16)15(3,4)5/h12-13H,1,6-10H2,2-5H3/t12-,13+/m1/s1 |
| InChIKey | MKEWPVDLTKADSP-OLZOCXBDSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|