C36H39O7P — CID 134975375
[(1S,2R,3R)-2-(3-dimethoxyphosphoryl-2-hydroxypropyl)-3-(trityloxymethyl)cyclobutyl] benzoate (PubChem CID 134975375) has the molecular formula C36H39O7P and a molecular weight of 614.68 g/mol. Its IUPAC name is [(1S,2R,3R)-2-(3-dimethoxyphosphoryl-2-hydroxypropyl)-3-(trityloxymethyl)cyclobutyl] benzoate.
| Compound Name | [(1S,2R,3R)-2-(3-dimethoxyphosphoryl-2-hydroxypropyl)-3-(trityloxymethyl)cyclobutyl] benzoate |
|---|---|
| PubChem CID | 134975375 |
| Molecular Formula | C36H39O7P |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | [(1S,2R,3R)-2-(3-dimethoxyphosphoryl-2-hydroxypropyl)-3-(trityloxymethyl)cyclobutyl] benzoate |
| SMILES | COP(=O)(CC(O)C[C@@H]1[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H]1OC(=O)c1ccccc1)OC |
| InChI | InChI=1S/C36H39O7P/c1-40-44(39,41-2)26-32(37)24-33-28(23-34(33)43-35(38)27-15-7-3-8-16-27)25-42-36(29-17-9-4-10-18-29,30-19-11-5-12-20-30)31-21-13-6-14-22-31/h3-22,28,32-34,37H,23-26H2,1-2H3/t28-,32?,33+,34-/m0/s1 |
| InChIKey | JPJOJYVSHXJNPP-NXEAJFBASA-N |
| XLogP | 7.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|