C25H28F6P2 — CID 134976511
4-ethyl-7,8-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium hexafluorophosphate (PubChem CID 134976511) has the molecular formula C25H28F6P2 and a molecular weight of 504.44 g/mol. Its IUPAC name is 4-ethyl-7,8-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium hexafluorophosphate.
| Compound Name | 4-ethyl-7,8-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium hexafluorophosphate |
|---|---|
| PubChem CID | 134976511 |
| Molecular Formula | C25H28F6P2 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 4-ethyl-7,8-dimethyl-2,2-diphenyl-3,4-dihydro-1H-isophosphinolin-2-ium hexafluorophosphate |
| SMILES | CCC1C[P+](c2ccccc2)(c2ccccc2)Cc2c1ccc(C)c2C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C25H28P.F6P/c1-4-21-17-26(22-11-7-5-8-12-22,23-13-9-6-10-14-23)18-25-20(3)19(2)15-16-24(21)25;1-7(2,3,4,5)6/h5-16,21H,4,17-18H2,1-3H3;/q+1;-1 |
| InChIKey | DRGORFYPSGDKTJ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|