C17H22O3 — CID 134976614
methyl (3aS,9bS)-8,8-dimethyl-3-oxo-3a,4,6,7,9,9a-hexahydrocyclopenta[a]naphthalene-9b-carboxylate (PubChem CID 134976614) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is methyl (3aS,9bS)-8,8-dimethyl-3-oxo-3a,4,6,7,9,9a-hexahydrocyclopenta[a]naphthalene-9b-carboxylate.
| Compound Name | methyl (3aS,9bS)-8,8-dimethyl-3-oxo-3a,4,6,7,9,9a-hexahydrocyclopenta[a]naphthalene-9b-carboxylate |
|---|---|
| PubChem CID | 134976614 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | methyl (3aS,9bS)-8,8-dimethyl-3-oxo-3a,4,6,7,9,9a-hexahydrocyclopenta[a]naphthalene-9b-carboxylate |
| SMILES | COC(=O)[C@]12C=CC(=O)[C@H]1CC=C1CCC(C)(C)CC12 |
| InChI | InChI=1S/C17H22O3/c1-16(2)8-6-11-4-5-12-14(18)7-9-17(12,13(11)10-16)15(19)20-3/h4,7,9,12-13H,5-6,8,10H2,1-3H3/t12-,13?,17-/m1/s1 |
| InChIKey | QGUODAOSTXSWLZ-HTCLMOQTSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|