C17H32N4 — CID 134976654
N,N-diethyl-4,6-dipentyltriazin-5-amine (PubChem CID 134976654) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is N,N-diethyl-4,6-dipentyltriazin-5-amine.
| Compound Name | N,N-diethyl-4,6-dipentyltriazin-5-amine |
|---|---|
| PubChem CID | 134976654 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | N,N-diethyl-4,6-dipentyltriazin-5-amine |
| SMILES | CCCCCc1nnnc(CCCCC)c1N(CC)CC |
| InChI | InChI=1S/C17H32N4/c1-5-9-11-13-15-17(21(7-3)8-4)16(19-20-18-15)14-12-10-6-2/h5-14H2,1-4H3 |
| InChIKey | RLWFWYLHNKVWCS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|