C11H10 — CID 134977123
1-buta-1,2,3-trienyl-2-ethynylcyclopentene (PubChem CID 134977123) has the molecular formula C11H10 and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-buta-1,2,3-trienyl-2-ethynylcyclopentene.
| Compound Name | 1-buta-1,2,3-trienyl-2-ethynylcyclopentene |
|---|---|
| PubChem CID | 134977123 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 1-buta-1,2,3-trienyl-2-ethynylcyclopentene |
| SMILES | C#CC1=C(C=C=C=C)CCC1 |
| InChI | InChI=1S/C11H10/c1-3-5-7-11-9-6-8-10(11)4-2/h2,7H,1,6,8-9H2 |
| InChIKey | JUTBWUUCBVVYJR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|