C14H22 — CID 134964122
(3Z,5E)-3,4,5-triethylocta-3,5-dien-1-yne (PubChem CID 134964122) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3Z,5E)-3,4,5-triethylocta-3,5-dien-1-yne.
| Compound Name | (3Z,5E)-3,4,5-triethylocta-3,5-dien-1-yne |
|---|---|
| PubChem CID | 134964122 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3Z,5E)-3,4,5-triethylocta-3,5-dien-1-yne |
| SMILES | C#C/C(CC)=C(CC)\C(=C\CC)CC |
| InChI | InChI=1S/C14H22/c1-6-11-13(9-4)14(10-5)12(7-2)8-3/h2,11H,6,8-10H2,1,3-5H3/b13-11+,14-12+ |
| InChIKey | QDUOZXLOWMAQND-PHEQNACWSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|