C12H13BO2 — CID 134978620
2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-1,3,2-dioxaborolane (PubChem CID 134978620) has the molecular formula C12H13BO2 and a molecular weight of 200.05 g/mol. Its IUPAC name is 2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-1,3,2-dioxaborolane.
| Compound Name | 2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134978620 |
| Molecular Formula | C12H13BO2 |
| Molecular Weight | 200.05 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]-1,3,2-dioxaborolane |
| SMILES | C(=C\B1OCCO1)\C=C\c1ccccc1 |
| InChI | InChI=1S/C12H13BO2/c1-2-6-12(7-3-1)8-4-5-9-13-14-10-11-15-13/h1-9H,10-11H2/b8-4+,9-5- |
| InChIKey | MNLGOHAVFWXVFD-HXGSSHHBSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.05 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|