C10H16OW — CID 134979753
[[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]tungsten (PubChem CID 134979753) has the molecular formula C10H16OW and a molecular weight of 336.08 g/mol. Its IUPAC name is [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]tungsten.
| Compound Name | [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]tungsten |
|---|---|
| PubChem CID | 134979753 |
| Molecular Formula | C10H16OW |
| Molecular Weight | 336.08 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]tungsten |
| SMILES | COC(=[W])[C@H]1CC=C(C)C[C@@H]1C |
| InChI | InChI=1S/C10H16O.W/c1-8-4-5-10(7-11-3)9(2)6-8;/h4,9-10H,5-6H2,1-3H3;/t9-,10+;/m0./s1 |
| InChIKey | SIMUYEUITPTUCX-BAUSSPIASA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.08 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|