C31H54O4Si — CID 134980371
(4R,8E,10S,11R,12E,14R,15R)-15-[(E,2R)-hept-3-en-2-yl]-4,11,14-trimethyl-5-methylidene-10-(2-trimethylsilylethoxymethoxy)-1-oxacyclopentadeca-8,12-dien-2-one (PubChem CID 134980371) has the molecular formula C31H54O4Si and a molecular weight of 518.86 g/mol. Its IUPAC name is (4R,8E,10S,11R,12E,14R,15R)-15-[(E,2R)-hept-3-en-2-yl]-4,11,14-trimethyl-5-methylidene-10-(2-trimethylsilylethoxymethoxy)-1-oxacyclopentadeca-8,12-dien-2-one.
| Compound Name | (4R,8E,10S,11R,12E,14R,15R)-15-[(E,2R)-hept-3-en-2-yl]-4,11,14-trimethyl-5-methylidene-10-(2-trimethylsilylethoxymethoxy)-1-oxacyclopentadeca-8,12-dien-2-one |
|---|---|
| PubChem CID | 134980371 |
| Molecular Formula | C31H54O4Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | (4R,8E,10S,11R,12E,14R,15R)-15-[(E,2R)-hept-3-en-2-yl]-4,11,14-trimethyl-5-methylidene-10-(2-trimethylsilylethoxymethoxy)-1-oxacyclopentadeca-8,12-dien-2-one |
| SMILES | C=C1CC/C=C/[C@H](OCOCC[Si](C)(C)C)[C@H](C)/C=C/[C@@H](C)[C@@H]([C@H](C)/C=C/CCC)OC(=O)C[C@H]1C |
| InChI | InChI=1S/C31H54O4Si/c1-10-11-12-16-26(4)31-27(5)19-18-25(3)29(34-23-33-20-21-36(7,8)9)17-14-13-15-24(2)28(6)22-30(32)35-31/h12,14,16-19,25-29,31H,2,10-11,13,15,20-23H2,1,3-9H3/b16-12+,17-14+,19-18+/t25-,26-,27-,28-,29+,31-/m1/s1 |
| InChIKey | VHJSCFUFPPGAJM-QXHRQTNOSA-N |
| XLogP | 8.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|