C19H36O4Si — CID 134982114
ethyl (2E,4E,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8-dimethylnona-2,4-dienoate (PubChem CID 134982114) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is ethyl (2E,4E,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8-dimethylnona-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8-dimethylnona-2,4-dienoate |
|---|---|
| PubChem CID | 134982114 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl (2E,4E,6S,7S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8-dimethylnona-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/[C@H](C)[C@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-9-22-17(20)13-11-10-12-15(2)18(21)16(3)14-23-24(7,8)19(4,5)6/h10-13,15-16,18,21H,9,14H2,1-8H3/b12-10+,13-11+/t15-,16-,18-/m0/s1 |
| InChIKey | HPOUTMHZACSONJ-VQUHOVMWSA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|