C34H50O7SSi — CID 134982159
2-(benzenesulfonyl)-2-[(1R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexyl]-1-[(4S,5R,6S)-6-ethenyl-5-methyl-2-phenyl-1,3-dioxan-4-yl]ethanol (PubChem CID 134982159) has the molecular formula C34H50O7SSi and a molecular weight of 630.92 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-[(1R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexyl]-1-[(4S,5R,6S)-6-ethenyl-5-methyl-2-phenyl-1,3-dioxan-4-yl]ethanol.
| Compound Name | 2-(benzenesulfonyl)-2-[(1R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexyl]-1-[(4S,5R,6S)-6-ethenyl-5-methyl-2-phenyl-1,3-dioxan-4-yl]ethanol |
|---|---|
| PubChem CID | 134982159 |
| Molecular Formula | C34H50O7SSi |
| Molecular Weight | 630.92 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 2-(benzenesulfonyl)-2-[(1R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxycyclohexyl]-1-[(4S,5R,6S)-6-ethenyl-5-methyl-2-phenyl-1,3-dioxan-4-yl]ethanol |
| SMILES | C=C[C@@H]1OC(c2ccccc2)O[C@H](C(O)C([C@@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC)C2)S(=O)(=O)c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C34H50O7SSi/c1-9-27-23(2)31(40-33(39-27)24-16-12-10-13-17-24)30(35)32(42(36,37)26-18-14-11-15-19-26)25-20-21-28(29(22-25)38-6)41-43(7,8)34(3,4)5/h9-19,23,25,27-33,35H,1,20-22H2,2-8H3/t23-,25-,27+,28-,29-,30?,31+,32?,33?/m1/s1 |
| InChIKey | XDXZPYNYMVSUOJ-LLZNUEGVSA-N |
| XLogP | 6.70 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.92 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|