C21H26O7S — CID 75046634
2-(hydroxymethyl)-6-methoxy-3-(4-methylphenyl)sulfonyl-5-phenylmethoxyoxan-4-ol (PubChem CID 75046634) has the molecular formula C21H26O7S and a molecular weight of 422.50 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-methoxy-3-(4-methylphenyl)sulfonyl-5-phenylmethoxyoxan-4-ol.
| Compound Name | 2-(hydroxymethyl)-6-methoxy-3-(4-methylphenyl)sulfonyl-5-phenylmethoxyoxan-4-ol |
|---|---|
| PubChem CID | 75046634 |
| Molecular Formula | C21H26O7S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-(hydroxymethyl)-6-methoxy-3-(4-methylphenyl)sulfonyl-5-phenylmethoxyoxan-4-ol |
| SMILES | COC1OC(CO)C(S(=O)(=O)c2ccc(C)cc2)C(O)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H26O7S/c1-14-8-10-16(11-9-14)29(24,25)20-17(12-22)28-21(26-2)19(18(20)23)27-13-15-6-4-3-5-7-15/h3-11,17-23H,12-13H2,1-2H3 |
| InChIKey | ZSLDOADUNRTZIM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |