C24H34O7S — CID 134983446
(1S,3R,4R,5R)-4-(benzenesulfonylmethyl)-5-[(Z)-6-(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)hex-2-enyl]cyclopentane-1,3-diol (PubChem CID 134983446) has the molecular formula C24H34O7S and a molecular weight of 466.60 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-(benzenesulfonylmethyl)-5-[(Z)-6-(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)hex-2-enyl]cyclopentane-1,3-diol.
| Compound Name | (1S,3R,4R,5R)-4-(benzenesulfonylmethyl)-5-[(Z)-6-(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)hex-2-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 134983446 |
| Molecular Formula | C24H34O7S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (1S,3R,4R,5R)-4-(benzenesulfonylmethyl)-5-[(Z)-6-(1-methyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)hex-2-enyl]cyclopentane-1,3-diol |
| SMILES | CC12OCC(CCC/C=C\C[C@@H]3[C@@H](CS(=O)(=O)c4ccccc4)[C@H](O)C[C@@H]3O)(CO1)CO2 |
| InChI | InChI=1S/C24H34O7S/c1-23-29-15-24(16-30-23,17-31-23)12-8-3-2-7-11-19-20(22(26)13-21(19)25)14-32(27,28)18-9-5-4-6-10-18/h2,4-7,9-10,19-22,25-26H,3,8,11-17H2,1H3/b7-2-/t19-,20-,21+,22-,23?,24?/m1/s1 |
| InChIKey | BYMKWLFIXHWWJZ-GXQYEKJSSA-N |
| XLogP | 2.67 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|