C17H19F3O2 — CID 134983475
1,2-dimethoxy-3-pent-4-enyl-6-(trifluoromethyl)-1H-indene (PubChem CID 134983475) has the molecular formula C17H19F3O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1,2-dimethoxy-3-pent-4-enyl-6-(trifluoromethyl)-1H-indene.
| Compound Name | 1,2-dimethoxy-3-pent-4-enyl-6-(trifluoromethyl)-1H-indene |
|---|---|
| PubChem CID | 134983475 |
| Molecular Formula | C17H19F3O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1,2-dimethoxy-3-pent-4-enyl-6-(trifluoromethyl)-1H-indene |
| SMILES | C=CCCCC1=C(OC)C(OC)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H19F3O2/c1-4-5-6-7-13-12-9-8-11(17(18,19)20)10-14(12)16(22-3)15(13)21-2/h4,8-10,16H,1,5-7H2,2-3H3 |
| InChIKey | RNSXBCMTFOUOMU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|