C27H46O2SiSn — CID 134983618
(1R,2S,3Z)-3-[(E)-3-tributylstannyl-1-trimethylsilylprop-2-enylidene]-1,2-dihydroindene-1,2-diol (PubChem CID 134983618) has the molecular formula C27H46O2SiSn and a molecular weight of 549.46 g/mol. Its IUPAC name is (1R,2S,3Z)-3-[(E)-3-tributylstannyl-1-trimethylsilylprop-2-enylidene]-1,2-dihydroindene-1,2-diol.
| Compound Name | (1R,2S,3Z)-3-[(E)-3-tributylstannyl-1-trimethylsilylprop-2-enylidene]-1,2-dihydroindene-1,2-diol |
|---|---|
| PubChem CID | 134983618 |
| Molecular Formula | C27H46O2SiSn |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (1R,2S,3Z)-3-[(E)-3-tributylstannyl-1-trimethylsilylprop-2-enylidene]-1,2-dihydroindene-1,2-diol |
| SMILES | CCCC[Sn](/C=C/C(=C1\c2ccccc2[C@@H](O)[C@H]1O)[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C15H19O2Si.3C4H9.Sn/c1-5-12(18(2,3)4)13-10-8-6-7-9-11(10)14(16)15(13)17;3*1-3-4-2;/h1,5-9,14-17H,2-4H3;3*1,3-4H2,2H3;/b5-1?,13-12-;;;;/t14-,15+;;;;/m1..../s1 |
| InChIKey | LBMZFPBRNUVVRU-SEOYAUSWSA-N |
| XLogP | 7.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|