C18H28O — CID 134985935
2-[(E)-4-methylpent-2-enoxy]-1,3-di(propan-2-yl)benzene (PubChem CID 134985935) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-[(E)-4-methylpent-2-enoxy]-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-[(E)-4-methylpent-2-enoxy]-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 134985935 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 2-[(E)-4-methylpent-2-enoxy]-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)/C=C/COc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C18H28O/c1-13(2)9-8-12-19-18-16(14(3)4)10-7-11-17(18)15(5)6/h7-11,13-15H,12H2,1-6H3/b9-8+ |
| InChIKey | NXCJBACLHKDQOJ-CMDGGOBGSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|