C16H23ClO — CID 77051114
2-(4-chlorobut-2-enoxy)-1,3-di(propan-2-yl)benzene (PubChem CID 77051114) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 2-(4-chlorobut-2-enoxy)-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-(4-chlorobut-2-enoxy)-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 77051114 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(4-chlorobut-2-enoxy)-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1OCC=CCCl |
| InChI | InChI=1S/C16H23ClO/c1-12(2)14-8-7-9-15(13(3)4)16(14)18-11-6-5-10-17/h5-9,12-13H,10-11H2,1-4H3 |
| InChIKey | MIPCNKYUVQRELO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|