C11H18O3 — CID 134989273
(3R,4aS,7aR)-6-methoxy-3,6-dimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one (PubChem CID 134989273) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3R,4aS,7aR)-6-methoxy-3,6-dimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one.
| Compound Name | (3R,4aS,7aR)-6-methoxy-3,6-dimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 134989273 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3R,4aS,7aR)-6-methoxy-3,6-dimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one |
| SMILES | COC1(C)C[C@@H]2C[C@@H](C)OC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C11H18O3/c1-7-4-8-5-11(2,13-3)6-9(8)10(12)14-7/h7-9H,4-6H2,1-3H3/t7-,8+,9-,11?/m1/s1 |
| InChIKey | WTUFUVBLAFBNHT-OCKNEMTGSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |