C12H9F3O4 — CID 134989458
6,7-dimethoxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 134989458) has the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 6,7-dimethoxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 134989458 |
| Molecular Formula | C12H9F3O4 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 6,7-dimethoxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | COc1cc2oc(C(F)(F)F)cc(=O)c2cc1OC |
| InChI | InChI=1S/C12H9F3O4/c1-17-9-3-6-7(16)4-11(12(13,14)15)19-8(6)5-10(9)18-2/h3-5H,1-2H3 |
| InChIKey | SPBXUGDIYPJBGJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |