C11H19N3 — CID 134989535
N,N-di(propan-2-yl)-1H-1,3-diazepin-2-amine (PubChem CID 134989535) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-1H-1,3-diazepin-2-amine.
| Compound Name | N,N-di(propan-2-yl)-1H-1,3-diazepin-2-amine |
|---|---|
| PubChem CID | 134989535 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N,N-di(propan-2-yl)-1H-1,3-diazepin-2-amine |
| SMILES | CC(C)N(C1=NC=CC=CN1)C(C)C |
| InChI | InChI=1S/C11H19N3/c1-9(2)14(10(3)4)11-12-7-5-6-8-13-11/h5-10H,1-4H3,(H,12,13) |
| InChIKey | JZDIKHUQIVTKHY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |