C12H20O3 — CID 134989581
(3S,4R,4aR,7aR)-6-methoxy-3,4,6-trimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one (PubChem CID 134989581) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3S,4R,4aR,7aR)-6-methoxy-3,4,6-trimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one.
| Compound Name | (3S,4R,4aR,7aR)-6-methoxy-3,4,6-trimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 134989581 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3S,4R,4aR,7aR)-6-methoxy-3,4,6-trimethyl-3,4,4a,5,7,7a-hexahydrocyclopenta[c]pyran-1-one |
| SMILES | COC1(C)C[C@@H]2[C@@H](C)[C@H](C)OC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C12H20O3/c1-7-8(2)15-11(13)10-6-12(3,14-4)5-9(7)10/h7-10H,5-6H2,1-4H3/t7-,8-,9+,10+,12?/m0/s1 |
| InChIKey | XKYVWJOKTZEWFF-WWIPMSHBSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |