C16H16ClNO — CID 134990737
(1R,4S)-2-chloro-7-(phenylmethoxymethyl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile (PubChem CID 134990737) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is (1R,4S)-2-chloro-7-(phenylmethoxymethyl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile.
| Compound Name | (1R,4S)-2-chloro-7-(phenylmethoxymethyl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 134990737 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (1R,4S)-2-chloro-7-(phenylmethoxymethyl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile |
| SMILES | N#CC1(Cl)C[C@H]2C=C[C@@H]1C2COCc1ccccc1 |
| InChI | InChI=1S/C16H16ClNO/c17-16(11-18)8-13-6-7-15(16)14(13)10-19-9-12-4-2-1-3-5-12/h1-7,13-15H,8-10H2/t13-,14?,15-,16?/m1/s1 |
| InChIKey | IYRIDYXKPLZEAH-YHNBSYBMSA-N |
| XLogP | 3.53 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|