C11H20O2Si — CID 134991077
(1R,6R)-4-methyl-6-trimethylsilylcyclohex-3-ene-1-carboxylic acid (PubChem CID 134991077) has the molecular formula C11H20O2Si and a molecular weight of 212.36 g/mol. Its IUPAC name is (1R,6R)-4-methyl-6-trimethylsilylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6R)-4-methyl-6-trimethylsilylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 134991077 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (1R,6R)-4-methyl-6-trimethylsilylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=CC[C@H](C(=O)O)[C@H]([Si](C)(C)C)C1 |
| InChI | InChI=1S/C11H20O2Si/c1-8-5-6-9(11(12)13)10(7-8)14(2,3)4/h5,9-10H,6-7H2,1-4H3,(H,12,13)/t9-,10+/m0/s1 |
| InChIKey | BKJWSIHYNHXSBQ-VHSXEESVSA-N |
| XLogP | 3.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|