C9H16O2 — CID 134992748
(2S,4R)-4-(methoxymethyl)-2-prop-2-enyloxolane (PubChem CID 134992748) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (2S,4R)-4-(methoxymethyl)-2-prop-2-enyloxolane.
| Compound Name | (2S,4R)-4-(methoxymethyl)-2-prop-2-enyloxolane |
|---|---|
| PubChem CID | 134992748 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2S,4R)-4-(methoxymethyl)-2-prop-2-enyloxolane |
| SMILES | C=CC[C@H]1C[C@H](COC)CO1 |
| InChI | InChI=1S/C9H16O2/c1-3-4-9-5-8(6-10-2)7-11-9/h3,8-9H,1,4-7H2,2H3/t8-,9+/m1/s1 |
| InChIKey | YJBQXDWOQGRUIQ-BDAKNGLRSA-N |
| XLogP | 1.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|