C13H24O3 — CID 134992868
(E,1S,2S)-1-cyclohexyl-2-(methoxymethoxy)pent-3-en-1-ol (PubChem CID 134992868) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (E,1S,2S)-1-cyclohexyl-2-(methoxymethoxy)pent-3-en-1-ol.
| Compound Name | (E,1S,2S)-1-cyclohexyl-2-(methoxymethoxy)pent-3-en-1-ol |
|---|---|
| PubChem CID | 134992868 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (E,1S,2S)-1-cyclohexyl-2-(methoxymethoxy)pent-3-en-1-ol |
| SMILES | C/C=C/[C@H](OCOC)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C13H24O3/c1-3-7-12(16-10-15-2)13(14)11-8-5-4-6-9-11/h3,7,11-14H,4-6,8-10H2,1-2H3/b7-3+/t12-,13-/m0/s1 |
| InChIKey | QRFLDFSZAYTQMM-NHTCQFRESA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|