C18H34O3 — CID 11381001
(1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]undecan-1-ol (PubChem CID 11381001) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is (1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]undecan-1-ol.
| Compound Name | (1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]undecan-1-ol |
|---|---|
| PubChem CID | 11381001 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | (1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]undecan-1-ol |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H]1C=CC[C@@H](OCC)O1 |
| InChI | InChI=1S/C18H34O3/c1-3-5-6-7-8-9-10-11-13-16(19)17-14-12-15-18(21-17)20-4-2/h12,14,16-19H,3-11,13,15H2,1-2H3/t16-,17-,18+/m1/s1 |
| InChIKey | APSJGXVCKPNKNO-KURKYZTESA-N |
| XLogP | 4.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|