About 1-azido-2-bromohexane
1-azido-2-bromohexane (PubChem CID 134993142) has the molecular formula C6H12BrN3
and a molecular weight of 206.09 g/mol. Its IUPAC name is 1-azido-2-bromohexane.
Molecular Properties
| Compound Name | 1-azido-2-bromohexane |
| PubChem CID | 134993142 |
| Molecular Formula | C6H12BrN3 |
| Molecular Weight | 206.09 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 1-azido-2-bromohexane |
| SMILES | CCCCC(Br)CN=[N+]=[N-] |
| InChI | InChI=1S/C6H12BrN3/c1-2-3-4-6(7)5-9-10-8/h6H,2-5H2,1H3 |
| InChIKey | WQYZYENKORVWQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-2-bromohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-2-bromohexane?
The IUPAC name of 1-azido-2-bromohexane (CID 134993142) is 1-azido-2-bromohexane.
What is the SMILES notation for 1-azido-2-bromohexane?
The canonical SMILES for 1-azido-2-bromohexane is CCCCC(Br)CN=[N+]=[N-].
What is the InChIKey of 1-azido-2-bromohexane?
The InChIKey is WQYZYENKORVWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12BrN3/c1-2-3-4-6(7)5-9-10-8/h6H,2-5H2,1H3.
What are the key properties of 1-azido-2-bromohexane?
1-azido-2-bromohexane has a molecular weight of 206.09 g/mol, XLogP of 3.25, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-2-bromohexane is sourced from PubChem (CID 134993142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).