About 1-azidohexan-2-yl diphenyl phosphate
1-azidohexan-2-yl diphenyl phosphate (PubChem CID 15441303) has the molecular formula C18H22N3O4P
and a molecular weight of 375.37 g/mol. Its IUPAC name is 1-azidohexan-2-yl diphenyl phosphate.
Molecular Properties
| Compound Name | 1-azidohexan-2-yl diphenyl phosphate |
| PubChem CID | 15441303 |
| Molecular Formula | C18H22N3O4P |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-azidohexan-2-yl diphenyl phosphate |
| SMILES | CCCCC(CN=[N+]=[N-])OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H22N3O4P/c1-2-3-10-18(15-20-21-19)25-26(22,23-16-11-6-4-7-12-16)24-17-13-8-5-9-14-17/h4-9,11-14,18H,2-3,10,15H2,1H3 |
| InChIKey | IHSBHTOOWWYEQT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azidohexan-2-yl diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidohexan-2-yl diphenyl phosphate?
The IUPAC name of 1-azidohexan-2-yl diphenyl phosphate (CID 15441303) is 1-azidohexan-2-yl diphenyl phosphate.
What is the SMILES notation for 1-azidohexan-2-yl diphenyl phosphate?
The canonical SMILES for 1-azidohexan-2-yl diphenyl phosphate is CCCCC(CN=[N+]=[N-])OP(=O)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 1-azidohexan-2-yl diphenyl phosphate?
The InChIKey is IHSBHTOOWWYEQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N3O4P/c1-2-3-10-18(15-20-21-19)25-26(22,23-16-11-6-4-7-12-16)24-17-13-8-5-9-14-17/h4-9,11-14,18H,2-3,10,15H2,1H3.
What are the key properties of 1-azidohexan-2-yl diphenyl phosphate?
1-azidohexan-2-yl diphenyl phosphate has a molecular weight of 375.37 g/mol, XLogP of 6.14, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidohexan-2-yl diphenyl phosphate is sourced from PubChem (CID 15441303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).