About copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane
copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane (PubChem CID 134993826) has the molecular formula C10H17CuO2
and a molecular weight of 232.79 g/mol. Its IUPAC name is copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane |
| PubChem CID | 134993826 |
| Molecular Formula | C10H17CuO2 |
| Molecular Weight | 232.79 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane |
| SMILES | [Cu+].[H]/[C-]=C(/CCCC)CC1OCCO1 |
| InChI | InChI=1S/C10H17O2.Cu/c1-3-4-5-9(2)8-10-11-6-7-12-10;/h2,10H,3-8H2,1H3;/q-1;+1 |
| InChIKey | AYRIFLWMAGWRDM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane?
The IUPAC name of copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane (CID 134993826) is copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane.
What is the SMILES notation for copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane?
The canonical SMILES for copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane is [Cu+].[H]/[C-]=C(/CCCC)CC1OCCO1.
What is the InChIKey of copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane?
The InChIKey is AYRIFLWMAGWRDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O2.Cu/c1-3-4-5-9(2)8-10-11-6-7-12-10;/h2,10H,3-8H2,1H3;/q-1;+1.
What are the key properties of copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane?
copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane has a molecular weight of 232.79 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);2-(2-methanidylidenehexyl)-1,3-dioxolane is sourced from PubChem (CID 134993826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).