About (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-)
(E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) (PubChem CID 134995385) has the molecular formula C4H6Cl7N2Sb
and a molecular weight of 452.04 g/mol. Its IUPAC name is (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-).
Molecular Properties
| Compound Name | (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) |
| PubChem CID | 134995385 |
| Molecular Formula | C4H6Cl7N2Sb |
| Molecular Weight | 452.04 g/mol |
| Exact Mass | 447.74 |
| IUPAC Name | (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) |
| SMILES | CC/C(Cl)=C\[N+]#N.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H6ClN2.6ClH.Sb/c1-2-4(5)3-7-6;;;;;;;/h3H,2H2,1H3;6*1H;/q+1;;;;;;;+5/p-6/b4-3+;;;;;;; |
| InChIKey | QYDCOLJELBUNKN-JLTWRGFHSA-H |
| XLogP | 6.09 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.04 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-)?
The IUPAC name of (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) (CID 134995385) is (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-).
What is the SMILES notation for (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-)?
The canonical SMILES for (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) is CC/C(Cl)=C\[N+]#N.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.
What is the InChIKey of (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-)?
The InChIKey is QYDCOLJELBUNKN-JLTWRGFHSA-H. The full InChI is InChI=1S/C4H6ClN2.6ClH.Sb/c1-2-4(5)3-7-6;;;;;;;/h3H,2H2,1H3;6*1H;/q+1;;;;;;;+5/p-6/b4-3+;;;;;;;.
What are the key properties of (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-)?
(E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) has a molecular weight of 452.04 g/mol, XLogP of 6.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-chlorobut-1-ene-1-diazonium;hexachloroantimony(1-) is sourced from PubChem (CID 134995385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).