About [butyl(nitro)amino] acetate
[butyl(nitro)amino] acetate (PubChem CID 134996088) has the molecular formula C6H12N2O4
and a molecular weight of 176.17 g/mol. Its IUPAC name is [butyl(nitro)amino] acetate.
Molecular Properties
| Compound Name | [butyl(nitro)amino] acetate |
| PubChem CID | 134996088 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | [butyl(nitro)amino] acetate |
| SMILES | CCCCN(OC(C)=O)[N+](=O)[O-] |
| InChI | InChI=1S/C6H12N2O4/c1-3-4-5-7(8(10)11)12-6(2)9/h3-5H2,1-2H3 |
| InChIKey | VVLZDRQVRVYMEL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [butyl(nitro)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butyl(nitro)amino] acetate?
The IUPAC name of [butyl(nitro)amino] acetate (CID 134996088) is [butyl(nitro)amino] acetate.
What is the SMILES notation for [butyl(nitro)amino] acetate?
The canonical SMILES for [butyl(nitro)amino] acetate is CCCCN(OC(C)=O)[N+](=O)[O-].
What is the InChIKey of [butyl(nitro)amino] acetate?
The InChIKey is VVLZDRQVRVYMEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O4/c1-3-4-5-7(8(10)11)12-6(2)9/h3-5H2,1-2H3.
What are the key properties of [butyl(nitro)amino] acetate?
[butyl(nitro)amino] acetate has a molecular weight of 176.17 g/mol, XLogP of 0.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [butyl(nitro)amino] acetate is sourced from PubChem (CID 134996088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).