C6H7F3INO — CID 134996148
(Z)-4-(dimethylamino)-1,1,1-trifluoro-3-iodobut-3-en-2-one (PubChem CID 134996148) has the molecular formula C6H7F3INO and a molecular weight of 293.03 g/mol. Its IUPAC name is (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-iodobut-3-en-2-one.
| Compound Name | (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-iodobut-3-en-2-one |
|---|---|
| PubChem CID | 134996148 |
| Molecular Formula | C6H7F3INO |
| Molecular Weight | 293.03 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-iodobut-3-en-2-one |
| SMILES | CN(C)/C=C(\I)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H7F3INO/c1-11(2)3-4(10)5(12)6(7,8)9/h3H,1-2H3/b4-3- |
| InChIKey | MBAIRNLQTXZSDA-ARJAWSKDSA-N |
| XLogP | 1.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|