C8H7Cl3F3NO2 — CID 135009627
(3Z)-1,1,1-trichloro-3-(dimethylaminomethylidene)-5,5,5-trifluoropentane-2,4-dione (PubChem CID 135009627) has the molecular formula C8H7Cl3F3NO2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (3Z)-1,1,1-trichloro-3-(dimethylaminomethylidene)-5,5,5-trifluoropentane-2,4-dione.
| Compound Name | (3Z)-1,1,1-trichloro-3-(dimethylaminomethylidene)-5,5,5-trifluoropentane-2,4-dione |
|---|---|
| PubChem CID | 135009627 |
| Molecular Formula | C8H7Cl3F3NO2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | (3Z)-1,1,1-trichloro-3-(dimethylaminomethylidene)-5,5,5-trifluoropentane-2,4-dione |
| SMILES | CN(C)/C=C(/C(=O)C(F)(F)F)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H7Cl3F3NO2/c1-15(2)3-4(5(16)7(9,10)11)6(17)8(12,13)14/h3H,1-2H3/b4-3+ |
| InChIKey | OERYCJPHAHVQIJ-ONEGZZNKSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|