C8H10N4S2 — CID 134998042
(1Z,2Z)-N,N'-bis(ethylsulfanyl)ethanediimidoyl dicyanide (PubChem CID 134998042) has the molecular formula C8H10N4S2 and a molecular weight of 226.33 g/mol. Its IUPAC name is (1Z,2Z)-N,N'-bis(ethylsulfanyl)ethanediimidoyl dicyanide.
| Compound Name | (1Z,2Z)-N,N'-bis(ethylsulfanyl)ethanediimidoyl dicyanide |
|---|---|
| PubChem CID | 134998042 |
| Molecular Formula | C8H10N4S2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | (1Z,2Z)-N,N'-bis(ethylsulfanyl)ethanediimidoyl dicyanide |
| SMILES | CCS/N=C(C#N)/C(C#N)=N/SCC |
| InChI | InChI=1S/C8H10N4S2/c1-3-13-11-7(5-9)8(6-10)12-14-4-2/h3-4H2,1-2H3/b11-7+,12-8+ |
| InChIKey | MHHCEHPSAYAETE-MKICQXMISA-N |
| XLogP | 2.25 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|