C20H29NO4S — CID 134999258
3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]nonanoyl]-1,3-oxazolidin-2-one (PubChem CID 134999258) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is 3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]nonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]nonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134999258 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]nonanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC(CC(=O)N1CCOC1=O)SCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H29NO4S/c1-3-4-5-6-7-18(14-19(22)21-12-13-25-20(21)23)26-15-16-8-10-17(24-2)11-9-16/h8-11,18H,3-7,12-15H2,1-2H3 |
| InChIKey | AZCJXBMGMPBHET-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|