C19H27NO4S — CID 135000818
3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]octanoyl]-1,3-oxazolidin-2-one (PubChem CID 135000818) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is 3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]octanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]octanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135000818 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3-[(3S)-3-[(4-methoxyphenyl)methylsulfanyl]octanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@@H](CC(=O)N1CCOC1=O)SCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H27NO4S/c1-3-4-5-6-17(13-18(21)20-11-12-24-19(20)22)25-14-15-7-9-16(23-2)10-8-15/h7-10,17H,3-6,11-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | XVZCHXHGMCWRBP-KRWDZBQOSA-N |
| XLogP | 4.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|