C20H14BrNOSe — CID 135000855
4-(4-bromophenyl)-2-(6-methoxynaphthalen-2-yl)-1,3-selenazole (PubChem CID 135000855) has the molecular formula C20H14BrNOSe and a molecular weight of 443.20 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-(6-methoxynaphthalen-2-yl)-1,3-selenazole.
| Compound Name | 4-(4-bromophenyl)-2-(6-methoxynaphthalen-2-yl)-1,3-selenazole |
|---|---|
| PubChem CID | 135000855 |
| Molecular Formula | C20H14BrNOSe |
| Molecular Weight | 443.20 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 4-(4-bromophenyl)-2-(6-methoxynaphthalen-2-yl)-1,3-selenazole |
| SMILES | COc1ccc2cc(-c3nc(-c4ccc(Br)cc4)c[se]3)ccc2c1 |
| InChI | InChI=1S/C20H14BrNOSe/c1-23-18-9-6-14-10-16(3-2-15(14)11-18)20-22-19(12-24-20)13-4-7-17(21)8-5-13/h2-12H,1H3 |
| InChIKey | TTYPTNFOINMVJH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.20 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|