C34H28F10N2O4S2Se2 — CID 139093303
[4-[4-(2,5-dimethoxyphenyl)-1,3-selenazol-2-yl]phenyl]-pentafluoro-λ6-sulfane (PubChem CID 139093303) has the molecular formula C34H28F10N2O4S2Se2 and a molecular weight of 940.64 g/mol. Its IUPAC name is [4-[4-(2,5-dimethoxyphenyl)-1,3-selenazol-2-yl]phenyl]-pentafluoro-λ6-sulfane.
| Compound Name | [4-[4-(2,5-dimethoxyphenyl)-1,3-selenazol-2-yl]phenyl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 139093303 |
| Molecular Formula | C34H28F10N2O4S2Se2 |
| Molecular Weight | 940.64 g/mol |
| Exact Mass | 941.97 |
| IUPAC Name | [4-[4-(2,5-dimethoxyphenyl)-1,3-selenazol-2-yl]phenyl]-pentafluoro-λ6-sulfane |
| SMILES | COc1ccc(OC)c(-c2c[se]c(-c3ccc(S(F)(F)(F)(F)F)cc3)n2)c1.COc1ccc(OC)c(-c2c[se]c(-c3ccc(S(F)(F)(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/2C17H14F5NO2SSe/c2*1-24-12-5-8-16(25-2)14(9-12)15-10-27-17(23-15)11-3-6-13(7-4-11)26(18,19,20,21)22/h2*3-10H,1-2H3 |
| InChIKey | VIAYSZKTEIKXQL-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.64 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|